C23H35NO2 — CID 142587164
propan-2-yl (2E,3Z,5E)-4-[(Z)-but-1-enyl]-2-ethylidene-5-methyl-3-[(Z)-1-methyliminobut-2-en-2-yl]octa-3,5-dienoate (PubChem CID 142587164) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is propan-2-yl (2E,3Z,5E)-4-[(Z)-but-1-enyl]-2-ethylidene-5-methyl-3-[(Z)-1-methyliminobut-2-en-2-yl]octa-3,5-dienoate.
| Compound Name | propan-2-yl (2E,3Z,5E)-4-[(Z)-but-1-enyl]-2-ethylidene-5-methyl-3-[(Z)-1-methyliminobut-2-en-2-yl]octa-3,5-dienoate |
|---|---|
| PubChem CID | 142587164 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | propan-2-yl (2E,3Z,5E)-4-[(Z)-but-1-enyl]-2-ethylidene-5-methyl-3-[(Z)-1-methyliminobut-2-en-2-yl]octa-3,5-dienoate |
| SMILES | C/C=C(\C=N\C)C(=C(\C=C/CC)C(/C)=C/CC)/C(=C\C)C(=O)OC(C)C |
| InChI | InChI=1S/C23H35NO2/c1-9-13-15-21(18(7)14-10-2)22(19(11-3)16-24-8)20(12-4)23(25)26-17(5)6/h11-17H,9-10H2,1-8H3/b15-13-,18-14+,19-11+,20-12+,22-21-,24-16+ |
| InChIKey | USQWJXKMORGKRJ-BGFAQICLSA-N |
| XLogP | 6.15 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|