C23H24N6O4S — CID 142588016
N-[[[5-(2-cyano-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]amino]-hydroxymethyl]-1-(oxolan-3-yl)pyrazole-3-sulfonamide (PubChem CID 142588016) has the molecular formula C23H24N6O4S and a molecular weight of 480.55 g/mol. Its IUPAC name is N-[[[5-(2-cyano-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]amino]-hydroxymethyl]-1-(oxolan-3-yl)pyrazole-3-sulfonamide.
| Compound Name | N-[[[5-(2-cyano-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]amino]-hydroxymethyl]-1-(oxolan-3-yl)pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 142588016 |
| Molecular Formula | C23H24N6O4S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-[[[5-(2-cyano-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]amino]-hydroxymethyl]-1-(oxolan-3-yl)pyrazole-3-sulfonamide |
| SMILES | N#Cc1cc(-c2ccc3c(c2NC(O)NS(=O)(=O)c2ccn(C4CCOC4)n2)CCC3)ccn1 |
| InChI | InChI=1S/C23H24N6O4S/c24-13-17-12-16(6-9-25-17)20-5-4-15-2-1-3-19(15)22(20)26-23(30)28-34(31,32)21-7-10-29(27-21)18-8-11-33-14-18/h4-7,9-10,12,18,23,26,28,30H,1-3,8,11,14H2 |
| InChIKey | IFKNNZNVMKICJF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|