C21H25N4NaO4S — CID 155796753
sodium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(oxan-4-yl)pyrazol-3-yl]sulfonylazanide (PubChem CID 155796753) has the molecular formula C21H25N4NaO4S and a molecular weight of 452.51 g/mol. Its IUPAC name is sodium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(oxan-4-yl)pyrazol-3-yl]sulfonylazanide.
| Compound Name | sodium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(oxan-4-yl)pyrazol-3-yl]sulfonylazanide |
|---|---|
| PubChem CID | 155796753 |
| Molecular Formula | C21H25N4NaO4S |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | sodium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(oxan-4-yl)pyrazol-3-yl]sulfonylazanide |
| SMILES | O=C([N-]S(=O)(=O)c1ccn(C2CCOCC2)n1)Nc1c2c(cc3c1CCC3)CCC2.[Na+] |
| InChI | InChI=1S/C21H26N4O4S.Na/c26-21(22-20-17-5-1-3-14(17)13-15-4-2-6-18(15)20)24-30(27,28)19-7-10-25(23-19)16-8-11-29-12-9-16;/h7,10,13,16H,1-6,8-9,11-12H2,(H2,22,24,26);/q;+1/p-1 |
| InChIKey | BQXNPFDKDHUSBV-UHFFFAOYSA-M |
| XLogP | 0.51 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |