C20H26N7NaO4S — CID 158292127
sodium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[(2-methyltetrazol-5-yl)-(oxan-4-yl)sulfamoyl]azanide (PubChem CID 158292127) has the molecular formula C20H26N7NaO4S and a molecular weight of 483.53 g/mol. Its IUPAC name is sodium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[(2-methyltetrazol-5-yl)-(oxan-4-yl)sulfamoyl]azanide.
| Compound Name | sodium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[(2-methyltetrazol-5-yl)-(oxan-4-yl)sulfamoyl]azanide |
|---|---|
| PubChem CID | 158292127 |
| Molecular Formula | C20H26N7NaO4S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | sodium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[(2-methyltetrazol-5-yl)-(oxan-4-yl)sulfamoyl]azanide |
| SMILES | Cn1nnc(N(C2CCOCC2)S(=O)(=O)[N-]C(=O)Nc2c3c(cc4c2CCC4)CCC3)n1.[Na+] |
| InChI | InChI=1S/C20H27N7O4S.Na/c1-26-23-19(22-25-26)27(15-8-10-31-11-9-15)32(29,30)24-20(28)21-18-16-6-2-4-13(16)12-14-5-3-7-17(14)18;/h12,15H,2-11H2,1H3,(H2,21,24,28);/q;+1/p-1 |
| InChIKey | YCPABVVSGKZJRU-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |