C21H28N6NaO4S — CID 155225246
CID 155225246 (PubChem CID 155225246) has the molecular formula C21H28N6NaO4S and a molecular weight of 483.55 g/mol.
| Compound Name | CID 155225246 |
|---|---|
| PubChem CID | 155225246 |
| Molecular Formula | C21H28N6NaO4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | — |
| SMILES | Cn1cnc(N(C2CCOCC2)S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)n1.[Na] |
| InChI | InChI=1S/C21H28N6O4S.Na/c1-26-13-22-20(24-26)27(16-8-10-31-11-9-16)32(29,30)25-21(28)23-19-17-6-2-4-14(17)12-15-5-3-7-18(15)19;/h12-13,16H,2-11H2,1H3,(H2,23,25,28); |
| InChIKey | SVSSBLRHPQVFNY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |