C23H28F3N5O4S — CID 147043030
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[oxan-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfamoyl]urea (PubChem CID 147043030) has the molecular formula C23H28F3N5O4S and a molecular weight of 527.57 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[oxan-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfamoyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[oxan-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfamoyl]urea |
|---|---|
| PubChem CID | 147043030 |
| Molecular Formula | C23H28F3N5O4S |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[oxan-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfamoyl]urea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)N(c1cnn(CC(F)(F)F)c1)C1CCOCC1 |
| InChI | InChI=1S/C23H28F3N5O4S/c24-23(25,26)14-30-13-18(12-27-30)31(17-7-9-35-10-8-17)36(33,34)29-22(32)28-21-19-5-1-3-15(19)11-16-4-2-6-20(16)21/h11-13,17H,1-10,14H2,(H2,28,29,32) |
| InChIKey | AZVBEMRXQKLGKP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |