C23H31N5NaO4S — CID 175825416
CID 175825416 (PubChem CID 175825416) has the molecular formula C23H31N5NaO4S and a molecular weight of 496.59 g/mol.
| Compound Name | CID 175825416 |
|---|---|
| PubChem CID | 175825416 |
| Molecular Formula | C23H31N5NaO4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | — |
| SMILES | C[C@H]1C[C@H](N(c2cnn(C)c2)S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)CCO1.[Na] |
| InChI | InChI=1S/C23H31N5O4S.Na/c1-15-11-18(9-10-32-15)28(19-13-24-27(2)14-19)33(30,31)26-23(29)25-22-20-7-3-5-16(20)12-17-6-4-8-21(17)22;/h12-15,18H,3-11H2,1-2H3,(H2,25,26,29);/t15-,18+;/m0./s1 |
| InChIKey | PPIALRRVELKAKA-QVNYQEOOSA-N |
| XLogP | 2.46 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |