C22H29N5O4S — CID 170689278
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methylpyrazol-4-yl)-(oxolan-3-ylmethyl)sulfamoyl]urea (PubChem CID 170689278) has the molecular formula C22H29N5O4S and a molecular weight of 459.57 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methylpyrazol-4-yl)-(oxolan-3-ylmethyl)sulfamoyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methylpyrazol-4-yl)-(oxolan-3-ylmethyl)sulfamoyl]urea |
|---|---|
| PubChem CID | 170689278 |
| Molecular Formula | C22H29N5O4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methylpyrazol-4-yl)-(oxolan-3-ylmethyl)sulfamoyl]urea |
| SMILES | Cn1cc(N(CC2CCOC2)S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)cn1 |
| InChI | InChI=1S/C22H29N5O4S/c1-26-13-18(11-23-26)27(12-15-8-9-31-14-15)32(29,30)25-22(28)24-21-19-6-2-4-16(19)10-17-5-3-7-20(17)21/h10-11,13,15H,2-9,12,14H2,1H3,(H2,24,25,28) |
| InChIKey | OYZXCECRMWMXRX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |