C24H31F3N6NaO3S — CID 155225310
CID 155225310 (PubChem CID 155225310) has the molecular formula C24H31F3N6NaO3S and a molecular weight of 563.60 g/mol.
| Compound Name | CID 155225310 |
|---|---|
| PubChem CID | 155225310 |
| Molecular Formula | C24H31F3N6NaO3S |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | — |
| SMILES | Cn1cc(N(C2CCN(CC(F)(F)F)CC2)S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)cn1.[Na] |
| InChI | InChI=1S/C24H31F3N6O3S.Na/c1-31-14-19(13-28-31)33(18-8-10-32(11-9-18)15-24(25,26)27)37(35,36)30-23(34)29-22-20-6-2-4-16(20)12-17-5-3-7-21(17)22;/h12-14,18H,2-11,15H2,1H3,(H2,29,30,34); |
| InChIKey | SZKIVFGKXWKAKO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |