C22H28N6NaO4S — CID 155225437
CID 155225437 (PubChem CID 155225437) has the molecular formula C22H28N6NaO4S and a molecular weight of 495.56 g/mol.
| Compound Name | CID 155225437 |
|---|---|
| PubChem CID | 155225437 |
| Molecular Formula | C22H28N6NaO4S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | — |
| SMILES | CN1CC(N(c2cnn(C)c2)S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)CC1=O.[Na] |
| InChI | InChI=1S/C22H28N6O4S.Na/c1-26-12-16(10-20(26)29)28(17-11-23-27(2)13-17)33(31,32)25-22(30)24-21-18-7-3-5-14(18)9-15-6-4-8-19(15)21;/h9,11,13,16H,3-8,10,12H2,1-2H3,(H2,24,25,30); |
| InChIKey | KOHJMHSMHSBODP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |