C24H33N5O4S — CID 155225206
1-[(3,3-dimethyloxan-4-yl)-(1-methylpyrazol-4-yl)sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 155225206) has the molecular formula C24H33N5O4S and a molecular weight of 487.63 g/mol. Its IUPAC name is 1-[(3,3-dimethyloxan-4-yl)-(1-methylpyrazol-4-yl)sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[(3,3-dimethyloxan-4-yl)-(1-methylpyrazol-4-yl)sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 155225206 |
| Molecular Formula | C24H33N5O4S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 1-[(3,3-dimethyloxan-4-yl)-(1-methylpyrazol-4-yl)sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | Cn1cc(N(C2CCOCC2(C)C)S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)cn1 |
| InChI | InChI=1S/C24H33N5O4S/c1-24(2)15-33-11-10-21(24)29(18-13-25-28(3)14-18)34(31,32)27-23(30)26-22-19-8-4-6-16(19)12-17-7-5-9-20(17)22/h12-14,21H,4-11,15H2,1-3H3,(H2,26,27,30) |
| InChIKey | FBTCSDGMLJKXEQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |