C25H31F3N6O3S — CID 155459273
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methylpyrazol-4-yl)-[2-(2,2,2-trifluoroethyl)-2-azaspiro[3.3]heptan-6-yl]sulfamoyl]urea (PubChem CID 155459273) has the molecular formula C25H31F3N6O3S and a molecular weight of 552.62 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methylpyrazol-4-yl)-[2-(2,2,2-trifluoroethyl)-2-azaspiro[3.3]heptan-6-yl]sulfamoyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methylpyrazol-4-yl)-[2-(2,2,2-trifluoroethyl)-2-azaspiro[3.3]heptan-6-yl]sulfamoyl]urea |
|---|---|
| PubChem CID | 155459273 |
| Molecular Formula | C25H31F3N6O3S |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methylpyrazol-4-yl)-[2-(2,2,2-trifluoroethyl)-2-azaspiro[3.3]heptan-6-yl]sulfamoyl]urea |
| SMILES | Cn1cc(N(C2CC3(C2)CN(CC(F)(F)F)C3)S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)cn1 |
| InChI | InChI=1S/C25H31F3N6O3S/c1-32-12-19(11-29-32)34(18-9-24(10-18)13-33(14-24)15-25(26,27)28)38(36,37)31-23(35)30-22-20-6-2-4-16(20)8-17-5-3-7-21(17)22/h8,11-12,18H,2-7,9-10,13-15H2,1H3,(H2,30,31,35) |
| InChIKey | WSOAKALIOMZXJW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |