C25H34N6O4S — CID 155225134
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methylpiperidin-4-yl)-[1-(oxetan-3-yl)pyrazol-4-yl]sulfamoyl]urea (PubChem CID 155225134) has the molecular formula C25H34N6O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methylpiperidin-4-yl)-[1-(oxetan-3-yl)pyrazol-4-yl]sulfamoyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methylpiperidin-4-yl)-[1-(oxetan-3-yl)pyrazol-4-yl]sulfamoyl]urea |
|---|---|
| PubChem CID | 155225134 |
| Molecular Formula | C25H34N6O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methylpiperidin-4-yl)-[1-(oxetan-3-yl)pyrazol-4-yl]sulfamoyl]urea |
| SMILES | CN1CCC(N(c2cnn(C3COC3)c2)S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)CC1 |
| InChI | InChI=1S/C25H34N6O4S/c1-29-10-8-19(9-11-29)31(20-13-26-30(14-20)21-15-35-16-21)36(33,34)28-25(32)27-24-22-6-2-4-17(22)12-18-5-3-7-23(18)24/h12-14,19,21H,2-11,15-16H2,1H3,(H2,27,28,32) |
| InChIKey | FRPIXERUOGKXRL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |