C23H29N5NaO4S — CID 155225191
CID 155225191 (PubChem CID 155225191) has the molecular formula C23H29N5NaO4S and a molecular weight of 494.57 g/mol.
| Compound Name | CID 155225191 |
|---|---|
| PubChem CID | 155225191 |
| Molecular Formula | C23H29N5NaO4S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | — |
| SMILES | Cc1ncc(N(C2CCOCC2)S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)cn1.[Na] |
| InChI | InChI=1S/C23H29N5O4S.Na/c1-15-24-13-19(14-25-15)28(18-8-10-32-11-9-18)33(30,31)27-23(29)26-22-20-6-2-4-16(20)12-17-5-3-7-21(17)22;/h12-14,18H,2-11H2,1H3,(H2,26,27,29); |
| InChIKey | XGMFTFXOYVPNIJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |