C21H28N6O4S — CID 155225247
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methyl-1,2,4-triazol-3-yl)-(oxan-4-yl)sulfamoyl]urea (PubChem CID 155225247) has the molecular formula C21H28N6O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methyl-1,2,4-triazol-3-yl)-(oxan-4-yl)sulfamoyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methyl-1,2,4-triazol-3-yl)-(oxan-4-yl)sulfamoyl]urea |
|---|---|
| PubChem CID | 155225247 |
| Molecular Formula | C21H28N6O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(1-methyl-1,2,4-triazol-3-yl)-(oxan-4-yl)sulfamoyl]urea |
| SMILES | Cn1cnc(N(C2CCOCC2)S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)n1 |
| InChI | InChI=1S/C21H28N6O4S/c1-26-13-22-20(24-26)27(16-8-10-31-11-9-16)32(29,30)25-21(28)23-19-17-6-2-4-14(17)12-15-5-3-7-18(15)19/h12-13,16H,2-11H2,1H3,(H2,23,25,28) |
| InChIKey | IFRHGPQIFMVIRT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |