C22H29N5NaO4S — CID 155225081
CID 155225081 (PubChem CID 155225081) has the molecular formula C22H29N5NaO4S and a molecular weight of 482.56 g/mol.
| Compound Name | CID 155225081 |
|---|---|
| PubChem CID | 155225081 |
| Molecular Formula | C22H29N5NaO4S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | — |
| SMILES | Cn1cnc(N(C2CCOCC2)S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)c1.[Na] |
| InChI | InChI=1S/C22H29N5O4S.Na/c1-26-13-20(23-14-26)27(17-8-10-31-11-9-17)32(29,30)25-22(28)24-21-18-6-2-4-15(18)12-16-5-3-7-19(16)21;/h12-14,17H,2-11H2,1H3,(H2,24,25,28); |
| InChIKey | KUJMSUVGQOBXLX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |