C13H26N2O3S — CID 142588187
1-[4,4-bis(hydroxymethyl)piperidin-1-yl]-6-(sulfanylamino)hexan-1-one (PubChem CID 142588187) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-[4,4-bis(hydroxymethyl)piperidin-1-yl]-6-(sulfanylamino)hexan-1-one.
| Compound Name | 1-[4,4-bis(hydroxymethyl)piperidin-1-yl]-6-(sulfanylamino)hexan-1-one |
|---|---|
| PubChem CID | 142588187 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-[4,4-bis(hydroxymethyl)piperidin-1-yl]-6-(sulfanylamino)hexan-1-one |
| SMILES | O=C(CCCCCNS)N1CCC(CO)(CO)CC1 |
| InChI | InChI=1S/C13H26N2O3S/c16-10-13(11-17)5-8-15(9-6-13)12(18)4-2-1-3-7-14-19/h14,16-17,19H,1-11H2 |
| InChIKey | QDXGEEXBPIVZCU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|