C14H23NO3 — CID 134168411
1-[4,4-bis(hydroxymethyl)piperidin-1-yl]hept-6-yn-1-one (PubChem CID 134168411) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-[4,4-bis(hydroxymethyl)piperidin-1-yl]hept-6-yn-1-one.
| Compound Name | 1-[4,4-bis(hydroxymethyl)piperidin-1-yl]hept-6-yn-1-one |
|---|---|
| PubChem CID | 134168411 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-[4,4-bis(hydroxymethyl)piperidin-1-yl]hept-6-yn-1-one |
| SMILES | C#CCCCCC(=O)N1CCC(CO)(CO)CC1 |
| InChI | InChI=1S/C14H23NO3/c1-2-3-4-5-6-13(18)15-9-7-14(11-16,12-17)8-10-15/h1,16-17H,3-12H2 |
| InChIKey | RHIIEQYTEPVHOT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|