C17H27F3N2O3 — CID 90101929
1-piperazin-1-ylundec-10-yn-1-one;2,2,2-trifluoroacetic acid (PubChem CID 90101929) has the molecular formula C17H27F3N2O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-piperazin-1-ylundec-10-yn-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-piperazin-1-ylundec-10-yn-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90101929 |
| Molecular Formula | C17H27F3N2O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-piperazin-1-ylundec-10-yn-1-one;2,2,2-trifluoroacetic acid |
| SMILES | C#CCCCCCCCCC(=O)N1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H26N2O.C2HF3O2/c1-2-3-4-5-6-7-8-9-10-15(18)17-13-11-16-12-14-17;3-2(4,5)1(6)7/h1,16H,3-14H2;(H,6,7) |
| InChIKey | LOQNELALDTWYOR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|