C20H19F4N5O5S — CID 142589603
ethyl 5-[2-[5-fluoro-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]-4-methylpyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 142589603) has the molecular formula C20H19F4N5O5S and a molecular weight of 517.46 g/mol. Its IUPAC name is ethyl 5-[2-[5-fluoro-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]-4-methylpyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 5-[2-[5-fluoro-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]-4-methylpyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 142589603 |
| Molecular Formula | C20H19F4N5O5S |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | ethyl 5-[2-[5-fluoro-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]-4-methylpyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1cnn2ccc(N3CC(C)CC3c3cc(F)cnc3OS(=O)(=O)C(F)(F)F)nc12 |
| InChI | InChI=1S/C20H19F4N5O5S/c1-3-33-19(30)14-9-26-29-5-4-16(27-17(14)29)28-10-11(2)6-15(28)13-7-12(21)8-25-18(13)34-35(31,32)20(22,23)24/h4-5,7-9,11,15H,3,6,10H2,1-2H3 |
| InChIKey | VTKCMUXNVLTLCA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 115.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|