C22H27FN6O2 — CID 153371908
ethyl 5-[(2S)-2-[2-[2-(ethylamino)ethyl]-5-fluoro-3-pyridinyl]pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 153371908) has the molecular formula C22H27FN6O2 and a molecular weight of 426.50 g/mol. Its IUPAC name is ethyl 5-[(2S)-2-[2-[2-(ethylamino)ethyl]-5-fluoro-3-pyridinyl]pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 5-[(2S)-2-[2-[2-(ethylamino)ethyl]-5-fluoro-3-pyridinyl]pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 153371908 |
| Molecular Formula | C22H27FN6O2 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | ethyl 5-[(2S)-2-[2-[2-(ethylamino)ethyl]-5-fluoro-3-pyridinyl]pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | CCNCCc1ncc(F)cc1[C@@H]1CCCN1c1ccn2ncc(C(=O)OCC)c2n1 |
| InChI | InChI=1S/C22H27FN6O2/c1-3-24-9-7-18-16(12-15(23)13-25-18)19-6-5-10-28(19)20-8-11-29-21(27-20)17(14-26-29)22(30)31-4-2/h8,11-14,19,24H,3-7,9-10H2,1-2H3/t19-/m0/s1 |
| InChIKey | QFWVZHGGONOVJU-IBGZPJMESA-N |
| XLogP | 2.93 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|