C22H29FN6O — CID 146271300
2-[3-[1-[3-(ethoxymethyl)pyrazolo[1,5-a]pyrimidin-5-yl]pyrrolidin-2-yl]-5-fluoro-2-pyridinyl]-N-ethylethanamine (PubChem CID 146271300) has the molecular formula C22H29FN6O and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[3-[1-[3-(ethoxymethyl)pyrazolo[1,5-a]pyrimidin-5-yl]pyrrolidin-2-yl]-5-fluoro-2-pyridinyl]-N-ethylethanamine.
| Compound Name | 2-[3-[1-[3-(ethoxymethyl)pyrazolo[1,5-a]pyrimidin-5-yl]pyrrolidin-2-yl]-5-fluoro-2-pyridinyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 146271300 |
| Molecular Formula | C22H29FN6O |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-[3-[1-[3-(ethoxymethyl)pyrazolo[1,5-a]pyrimidin-5-yl]pyrrolidin-2-yl]-5-fluoro-2-pyridinyl]-N-ethylethanamine |
| SMILES | CCNCCc1ncc(F)cc1C1CCCN1c1ccn2ncc(COCC)c2n1 |
| InChI | InChI=1S/C22H29FN6O/c1-3-24-9-7-19-18(12-17(23)14-25-19)20-6-5-10-28(20)21-8-11-29-22(27-21)16(13-26-29)15-30-4-2/h8,11-14,20,24H,3-7,9-10,15H2,1-2H3 |
| InChIKey | HVLHYYWPBMMWML-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|