C28H37N3O3 — CID 142589717
N-[4-[2-(aminomethyl)phenyl]butyl]-N-[2-[2-methyl-5-(3-oxa-8-azabicyclo[3.2.1]octane-8-carbonyl)phenyl]ethyl]formamide (PubChem CID 142589717) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-[4-[2-(aminomethyl)phenyl]butyl]-N-[2-[2-methyl-5-(3-oxa-8-azabicyclo[3.2.1]octane-8-carbonyl)phenyl]ethyl]formamide.
| Compound Name | N-[4-[2-(aminomethyl)phenyl]butyl]-N-[2-[2-methyl-5-(3-oxa-8-azabicyclo[3.2.1]octane-8-carbonyl)phenyl]ethyl]formamide |
|---|---|
| PubChem CID | 142589717 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[4-[2-(aminomethyl)phenyl]butyl]-N-[2-[2-methyl-5-(3-oxa-8-azabicyclo[3.2.1]octane-8-carbonyl)phenyl]ethyl]formamide |
| SMILES | Cc1ccc(C(=O)N2C3CCC2COC3)cc1CCN(C=O)CCCCc1ccccc1CN |
| InChI | InChI=1S/C28H37N3O3/c1-21-9-10-24(28(33)31-26-11-12-27(31)19-34-18-26)16-23(21)13-15-30(20-32)14-5-4-7-22-6-2-3-8-25(22)17-29/h2-3,6,8-10,16,20,26-27H,4-5,7,11-15,17-19,29H2,1H3 |
| InChIKey | GDMYWCXDIDTKSB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|