C27H35N3O3 — CID 142589743
2-[(5E)-6-(aminomethyl)-5-ethenylocta-5,7-dienyl]-6-(3-oxa-8-azabicyclo[3.2.1]octane-8-carbonyl)-3,4-dihydroisoquinolin-1-one (PubChem CID 142589743) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 2-[(5E)-6-(aminomethyl)-5-ethenylocta-5,7-dienyl]-6-(3-oxa-8-azabicyclo[3.2.1]octane-8-carbonyl)-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-[(5E)-6-(aminomethyl)-5-ethenylocta-5,7-dienyl]-6-(3-oxa-8-azabicyclo[3.2.1]octane-8-carbonyl)-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 142589743 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 2-[(5E)-6-(aminomethyl)-5-ethenylocta-5,7-dienyl]-6-(3-oxa-8-azabicyclo[3.2.1]octane-8-carbonyl)-3,4-dihydroisoquinolin-1-one |
| SMILES | C=C/C(CN)=C(\C=C)CCCCN1CCc2cc(C(=O)N3C4CCC3COC4)ccc2C1=O |
| InChI | InChI=1S/C27H35N3O3/c1-3-19(20(4-2)16-28)7-5-6-13-29-14-12-21-15-22(8-11-25(21)27(29)32)26(31)30-23-9-10-24(30)18-33-17-23/h3-4,8,11,15,23-24H,1-2,5-7,9-10,12-14,16-18,28H2/b20-19- |
| InChIKey | PRUQPOTZBMUEFS-VXPUYCOJSA-N |
| XLogP | 3.49 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|