C22H27NO10S — CID 142590122
[3-[2-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-4-methoxyphenyl] methanesulfonate (PubChem CID 142590122) has the molecular formula C22H27NO10S and a molecular weight of 497.52 g/mol. Its IUPAC name is [3-[2-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-4-methoxyphenyl] methanesulfonate.
| Compound Name | [3-[2-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-4-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 142590122 |
| Molecular Formula | C22H27NO10S |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | [3-[2-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-4-methoxyphenyl] methanesulfonate |
| SMILES | COc1ccc(OS(C)(=O)=O)cc1-c1ccccc1O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C22H27NO10S/c1-12(25)23-19-21(27)20(26)18(11-24)32-22(19)31-17-7-5-4-6-14(17)15-10-13(33-34(3,28)29)8-9-16(15)30-2/h4-10,18-22,24,26-27H,11H2,1-3H3,(H,23,25)/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | LSOURCKRNUBXMA-QMCAAQAGSA-N |
| XLogP | 0.02 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|