8-methylquinazolin-2-amine;molecular hydrogen

C9H11N3 — CID 142590391

IUPAC8-methylquinazolin-2-amine;molecular hydrogen
SMILESCc1cccc2cnc(N)nc12.[H][H]
InChIInChI=1S/C9H9N3.H2/c1-6-3-2-4-7-5-11-9(10)12-8(6)7;/h2-5H,1H3,(H2,10,11,12);1H
InChIKeySFAIOVVQMLFYMF-UHFFFAOYSA-N
MW161.21 g/mol
LogP1.77
Rot. Bonds

About 8-methylquinazolin-2-amine;molecular hydrogen

8-methylquinazolin-2-amine;molecular hydrogen (PubChem CID 142590391) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 8-methylquinazolin-2-amine;molecular hydrogen.

Molecular Properties

Compound Name8-methylquinazolin-2-amine;molecular hydrogen
PubChem CID142590391
Molecular FormulaC9H11N3
Molecular Weight161.21 g/mol
Exact Mass161.10
IUPAC Name8-methylquinazolin-2-amine;molecular hydrogen
SMILESCc1cccc2cnc(N)nc12.[H][H]
InChIInChI=1S/C9H9N3.H2/c1-6-3-2-4-7-5-11-9(10)12-8(6)7;/h2-5H,1H3,(H2,10,11,12);1H
InChIKeySFAIOVVQMLFYMF-UHFFFAOYSA-N
XLogP1.77
TPSA51.80 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.21
LogP ≤ 51.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 8-methylquinazolin-2-amine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-methylquinazolin-2-amine;molecular hydrogen?
The IUPAC name of 8-methylquinazolin-2-amine;molecular hydrogen (CID 142590391) is 8-methylquinazolin-2-amine;molecular hydrogen.
What is the SMILES notation for 8-methylquinazolin-2-amine;molecular hydrogen?
The canonical SMILES for 8-methylquinazolin-2-amine;molecular hydrogen is Cc1cccc2cnc(N)nc12.[H][H].
What is the InChIKey of 8-methylquinazolin-2-amine;molecular hydrogen?
The InChIKey is SFAIOVVQMLFYMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.H2/c1-6-3-2-4-7-5-11-9(10)12-8(6)7;/h2-5H,1H3,(H2,10,11,12);1H.
What are the key properties of 8-methylquinazolin-2-amine;molecular hydrogen?
8-methylquinazolin-2-amine;molecular hydrogen has a molecular weight of 161.21 g/mol, XLogP of 1.77, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylquinazolin-2-amine;molecular hydrogen is sourced from PubChem (CID 142590391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).