C30H51NO2 — CID 142590555
(1R,3aS,5aR,5bR,7aR,9S,11aR,13bS)-1-(3-aminoprop-1-en-2-yl)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol (PubChem CID 142590555) has the molecular formula C30H51NO2 and a molecular weight of 457.74 g/mol. Its IUPAC name is (1R,3aS,5aR,5bR,7aR,9S,11aR,13bS)-1-(3-aminoprop-1-en-2-yl)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol.
| Compound Name | (1R,3aS,5aR,5bR,7aR,9S,11aR,13bS)-1-(3-aminoprop-1-en-2-yl)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
|---|---|
| PubChem CID | 142590555 |
| Molecular Formula | C30H51NO2 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 457.39 |
| IUPAC Name | (1R,3aS,5aR,5bR,7aR,9S,11aR,13bS)-1-(3-aminoprop-1-en-2-yl)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
| SMILES | C=C(CN)[C@@H]1CC[C@]2(CO)CC[C@]3(C)C(CCC4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C30H51NO2/c1-19(17-31)20-9-14-30(18-32)16-15-28(5)21(25(20)30)7-8-23-27(4)12-11-24(33)26(2,3)22(27)10-13-29(23,28)6/h20-25,32-33H,1,7-18,31H2,2-6H3/t20-,21?,22-,23?,24-,25+,27-,28+,29+,30+/m0/s1 |
| InChIKey | KANHOONYHIGPDN-MZTKBMMCSA-N |
| XLogP | 5.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|