C30H50O4 — CID 75095685
3a,8-bis(hydroxymethyl)-1-(3-hydroxyprop-1-en-2-yl)-5a,5b,8,11a-tetramethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol (PubChem CID 75095685) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is 3a,8-bis(hydroxymethyl)-1-(3-hydroxyprop-1-en-2-yl)-5a,5b,8,11a-tetramethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol.
| Compound Name | 3a,8-bis(hydroxymethyl)-1-(3-hydroxyprop-1-en-2-yl)-5a,5b,8,11a-tetramethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
|---|---|
| PubChem CID | 75095685 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | 3a,8-bis(hydroxymethyl)-1-(3-hydroxyprop-1-en-2-yl)-5a,5b,8,11a-tetramethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
| SMILES | C=C(CO)C1CCC2(CO)CCC3(C)C(CCC4C5(C)CCC(O)C(C)(CO)C5CCC43C)C12 |
| InChI | InChI=1S/C30H50O4/c1-19(16-31)20-8-13-30(18-33)15-14-28(4)21(25(20)30)6-7-23-26(2)11-10-24(34)27(3,17-32)22(26)9-12-29(23,28)5/h20-25,31-34H,1,6-18H2,2-5H3 |
| InChIKey | CVLQOOCCOYPXIF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|