C32H52O4 — CID 90728245
[9-hydroxy-8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl acetate (PubChem CID 90728245) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is [9-hydroxy-8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl acetate.
| Compound Name | [9-hydroxy-8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl acetate |
|---|---|
| PubChem CID | 90728245 |
| Molecular Formula | C32H52O4 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | [9-hydroxy-8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl acetate |
| SMILES | C=C(C)C1CCC2(COC(C)=O)CCC3(C)C(CCC4C5(C)CCC(O)C(C)(CO)C5CCC43C)C12 |
| InChI | InChI=1S/C32H52O4/c1-20(2)22-10-15-32(19-36-21(3)34)17-16-30(6)23(27(22)32)8-9-25-28(4)13-12-26(35)29(5,18-33)24(28)11-14-31(25,30)7/h22-27,33,35H,1,8-19H2,2-7H3 |
| InChIKey | CPXLAKYXAFOIBJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|