C35H56O4 — CID 91176498
[3a-(acetyloxymethyl)-5a,5b,8,9,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-8-yl]methyl acetate (PubChem CID 91176498) has the molecular formula C35H56O4 and a molecular weight of 540.83 g/mol. Its IUPAC name is [3a-(acetyloxymethyl)-5a,5b,8,9,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-8-yl]methyl acetate.
| Compound Name | [3a-(acetyloxymethyl)-5a,5b,8,9,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-8-yl]methyl acetate |
|---|---|
| PubChem CID | 91176498 |
| Molecular Formula | C35H56O4 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.42 |
| IUPAC Name | [3a-(acetyloxymethyl)-5a,5b,8,9,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-8-yl]methyl acetate |
| SMILES | C=C(C)C1CCC2(COC(C)=O)CCC3(C)C(CCC4C5(C)CCC(C)C(C)(COC(C)=O)C5CCC43C)C12 |
| InChI | InChI=1S/C35H56O4/c1-22(2)26-13-17-35(21-39-25(5)37)19-18-33(8)27(30(26)35)10-11-29-31(6)15-12-23(3)32(7,20-38-24(4)36)28(31)14-16-34(29,33)9/h23,26-30H,1,10-21H2,2-9H3 |
| InChIKey | ZGIIEMHYUQYRKZ-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|