C32H54O — CID 91145951
(8-ethyl-5a,5b,8,9,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)methanol (PubChem CID 91145951) has the molecular formula C32H54O and a molecular weight of 454.78 g/mol. Its IUPAC name is (8-ethyl-5a,5b,8,9,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)methanol.
| Compound Name | (8-ethyl-5a,5b,8,9,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)methanol |
|---|---|
| PubChem CID | 91145951 |
| Molecular Formula | C32H54O |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 454.42 |
| IUPAC Name | (8-ethyl-5a,5b,8,9,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)methanol |
| SMILES | C=C(C)C1CCC2(CO)CCC3(C)C(CCC4C5(C)CCC(C)C(C)(CC)C5CCC43C)C12 |
| InChI | InChI=1S/C32H54O/c1-9-28(5)22(4)12-15-29(6)25(28)14-16-31(8)26(29)11-10-24-27-23(21(2)3)13-17-32(27,20-33)19-18-30(24,31)7/h22-27,33H,2,9-20H2,1,3-8H3 |
| InChIKey | FTENCPPJVBVZAI-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|