C33H56O — CID 76812940
(1-but-1-en-2-yl-8-ethyl-5a,5b,8,9,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)methanol (PubChem CID 76812940) has the molecular formula C33H56O and a molecular weight of 468.81 g/mol. Its IUPAC name is (1-but-1-en-2-yl-8-ethyl-5a,5b,8,9,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)methanol.
| Compound Name | (1-but-1-en-2-yl-8-ethyl-5a,5b,8,9,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)methanol |
|---|---|
| PubChem CID | 76812940 |
| Molecular Formula | C33H56O |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.43 |
| IUPAC Name | (1-but-1-en-2-yl-8-ethyl-5a,5b,8,9,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)methanol |
| SMILES | C=C(CC)C1CCC2(CO)CCC3(C)C(CCC4C5(C)CCC(C)C(C)(CC)C5CCC43C)C12 |
| InChI | InChI=1S/C33H56O/c1-9-22(3)24-14-18-33(21-34)20-19-31(7)25(28(24)33)11-12-27-30(6)16-13-23(4)29(5,10-2)26(30)15-17-32(27,31)8/h23-28,34H,3,9-21H2,1-2,4-8H3 |
| InChIKey | OFMVELBMPQXRKF-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|