C32H52O2 — CID 90759060
[1-but-1-en-2-yl-3a-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-9-methylidene-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-8-yl]methanol (PubChem CID 90759060) has the molecular formula C32H52O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is [1-but-1-en-2-yl-3a-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-9-methylidene-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-8-yl]methanol.
| Compound Name | [1-but-1-en-2-yl-3a-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-9-methylidene-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-8-yl]methanol |
|---|---|
| PubChem CID | 90759060 |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | [1-but-1-en-2-yl-3a-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-9-methylidene-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-8-yl]methanol |
| SMILES | C=C(CC)C1CCC2(CO)CCC3(C)C(CCC4C5(C)CCC(=C)C(C)(CO)C5CCC43C)C12 |
| InChI | InChI=1S/C32H52O2/c1-8-21(2)23-12-16-32(20-34)18-17-30(6)24(27(23)32)9-10-26-28(4)14-11-22(3)29(5,19-33)25(28)13-15-31(26,30)7/h23-27,33-34H,2-3,8-20H2,1,4-7H3 |
| InChIKey | ASFQUOPPYHPPGZ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|