C31H47NO — CID 91062181
8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-9-methylidene-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carbonitrile (PubChem CID 91062181) has the molecular formula C31H47NO and a molecular weight of 449.72 g/mol. Its IUPAC name is 8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-9-methylidene-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carbonitrile.
| Compound Name | 8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-9-methylidene-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carbonitrile |
|---|---|
| PubChem CID | 91062181 |
| Molecular Formula | C31H47NO |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 449.37 |
| IUPAC Name | 8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-9-methylidene-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carbonitrile |
| SMILES | C=C(C)C1CCC2(C#N)CCC3(C)C(CCC4C5(C)CCC(=C)C(C)(CO)C5CCC43C)C12 |
| InChI | InChI=1S/C31H47NO/c1-20(2)22-11-15-31(18-32)17-16-29(6)23(26(22)31)8-9-25-27(4)13-10-21(3)28(5,19-33)24(27)12-14-30(25,29)7/h22-26,33H,1,3,8-17,19H2,2,4-7H3 |
| InChIKey | WJFJXEZIROWRIJ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|