C31H48O3 — CID 89312725
[(1R,3aS,5aR,5bR,8R,11aS)-5a,5b,8,11a-tetramethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,8,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl acetate (PubChem CID 89312725) has the molecular formula C31H48O3 and a molecular weight of 468.72 g/mol. Its IUPAC name is [(1R,3aS,5aR,5bR,8R,11aS)-5a,5b,8,11a-tetramethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,8,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl acetate.
| Compound Name | [(1R,3aS,5aR,5bR,8R,11aS)-5a,5b,8,11a-tetramethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,8,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl acetate |
|---|---|
| PubChem CID | 89312725 |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | [(1R,3aS,5aR,5bR,8R,11aS)-5a,5b,8,11a-tetramethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,8,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl acetate |
| SMILES | C=C(C)C1CC[C@]2(COC(C)=O)CC[C@]3(C)C(CCC4[C@@]5(C)CCC(=O)[C@H](C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C31H48O3/c1-19(2)22-10-15-31(18-34-21(4)32)17-16-29(6)24(27(22)31)8-9-26-28(5)13-12-25(33)20(3)23(28)11-14-30(26,29)7/h20,22-24,26-27H,1,8-18H2,2-7H3/t20-,22?,23?,24?,26?,27?,28+,29-,30-,31-/m1/s1 |
| InChIKey | SQLGBWNPOQFPJP-QHAPYYQHSA-N |
| XLogP | 7.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|