C50H34N6S — CID 142592804
N'-benzyl-N-[(methylideneamino)-(4-phenylphenyl)methylidene]-2-(9-phenylcarbazol-1-yl)-[1]benzothiolo[3,2-d]pyrimidine-4-carboximidamide (PubChem CID 142592804) has the molecular formula C50H34N6S and a molecular weight of 750.93 g/mol. Its IUPAC name is N'-benzyl-N-[(methylideneamino)-(4-phenylphenyl)methylidene]-2-(9-phenylcarbazol-1-yl)-[1]benzothiolo[3,2-d]pyrimidine-4-carboximidamide.
| Compound Name | N'-benzyl-N-[(methylideneamino)-(4-phenylphenyl)methylidene]-2-(9-phenylcarbazol-1-yl)-[1]benzothiolo[3,2-d]pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 142592804 |
| Molecular Formula | C50H34N6S |
| Molecular Weight | 750.93 g/mol |
| Exact Mass | 750.26 |
| IUPAC Name | N'-benzyl-N-[(methylideneamino)-(4-phenylphenyl)methylidene]-2-(9-phenylcarbazol-1-yl)-[1]benzothiolo[3,2-d]pyrimidine-4-carboximidamide |
| SMILES | C=N/C(=N\C(=N/Cc1ccccc1)c1nc(-c2cccc3c4ccccc4n(-c4ccccc4)c23)nc2c1sc1ccccc12)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C50H34N6S/c1-51-48(36-30-28-35(29-31-36)34-18-7-3-8-19-34)55-50(52-32-33-16-5-2-6-17-33)45-47-44(40-23-12-14-27-43(40)57-47)53-49(54-45)41-25-15-24-39-38-22-11-13-26-42(38)56(46(39)41)37-20-9-4-10-21-37/h2-31H,1,32H2/b52-50-,55-48- |
| InChIKey | CVEKJBFRSWUCNX-GJXPMIMWSA-N |
| XLogP | 12.37 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.93 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|