C46H34N4S — CID 170137481
4-(1-dibenzothiophen-4-ylcarbazol-9-yl)-N'-[(1Z,3Z,5E)-hepta-1,3,5-trienyl]-N-[(methylideneamino)-phenylmethylidene]benzenecarboximidamide (PubChem CID 170137481) has the molecular formula C46H34N4S and a molecular weight of 674.87 g/mol. Its IUPAC name is 4-(1-dibenzothiophen-4-ylcarbazol-9-yl)-N'-[(1Z,3Z,5E)-hepta-1,3,5-trienyl]-N-[(methylideneamino)-phenylmethylidene]benzenecarboximidamide.
| Compound Name | 4-(1-dibenzothiophen-4-ylcarbazol-9-yl)-N'-[(1Z,3Z,5E)-hepta-1,3,5-trienyl]-N-[(methylideneamino)-phenylmethylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 170137481 |
| Molecular Formula | C46H34N4S |
| Molecular Weight | 674.87 g/mol |
| Exact Mass | 674.25 |
| IUPAC Name | 4-(1-dibenzothiophen-4-ylcarbazol-9-yl)-N'-[(1Z,3Z,5E)-hepta-1,3,5-trienyl]-N-[(methylideneamino)-phenylmethylidene]benzenecarboximidamide |
| SMILES | C=N/C(=N\C(=N/C=C\C=C/C=C/C)c1ccc(-n2c3ccccc3c3cccc(-c4cccc5c4sc4ccccc45)c32)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H34N4S/c1-3-4-5-6-14-31-48-46(49-45(47-2)32-17-8-7-9-18-32)33-27-29-34(30-28-33)50-41-25-12-10-19-35(41)37-21-15-22-38(43(37)50)40-24-16-23-39-36-20-11-13-26-42(36)51-44(39)40/h3-31H,2H2,1H3/b4-3+,6-5-,31-14-,48-46-,49-45- |
| InChIKey | OOWFDMBTZNYPOP-RGSVUPMYSA-N |
| XLogP | 12.36 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.87 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|