C35H32BO2 — CID 142592951
CID 142592951 (PubChem CID 142592951) has the molecular formula C35H32BO2 and a molecular weight of 495.45 g/mol.
| Compound Name | CID 142592951 |
|---|---|
| PubChem CID | 142592951 |
| Molecular Formula | C35H32BO2 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1ccc(C2(c3ccccc3)c3ccccc3-c3c2ccc2ccccc32)cc1 |
| InChI | InChI=1S/C35H32BO2/c1-33(2,37)34(3,4)38-36-27-21-19-26(20-22-27)35(25-13-6-5-7-14-25)30-17-11-10-16-29(30)32-28-15-9-8-12-24(28)18-23-31(32)35/h5-23,37H,1-4H3 |
| InChIKey | CZWZSLPDMALWAO-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|