C43H37BNO2 — CID 147966108
CID 147966108 (PubChem CID 147966108) has the molecular formula C43H37BNO2 and a molecular weight of 610.59 g/mol.
| Compound Name | CID 147966108 |
|---|---|
| PubChem CID | 147966108 |
| Molecular Formula | C43H37BNO2 |
| Molecular Weight | 610.59 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1ccc2c(c1)c1ccccc1n2-c1ccc2c(c1)-c1ccccc1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H37BNO2/c1-41(2,46)42(3,4)47-44-31-23-26-40-36(27-31)34-20-12-14-22-39(34)45(40)32-24-25-38-35(28-32)33-19-11-13-21-37(33)43(38,29-15-7-5-8-16-29)30-17-9-6-10-18-30/h5-28,46H,1-4H3 |
| InChIKey | QLECVJOZNDNLIQ-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.59 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|