C30H37F2N5O2 — CID 142595681
N-[2-[[5-ethyl-2-[[(1S,3S)-3-fluorocyclohexyl]methoxy]-6-[[(8-methylnaphthalen-1-yl)amino]methyl]pyrimidin-4-yl]amino]ethyl]-2-fluoroprop-2-enamide (PubChem CID 142595681) has the molecular formula C30H37F2N5O2 and a molecular weight of 537.66 g/mol. Its IUPAC name is N-[2-[[5-ethyl-2-[[(1S,3S)-3-fluorocyclohexyl]methoxy]-6-[[(8-methylnaphthalen-1-yl)amino]methyl]pyrimidin-4-yl]amino]ethyl]-2-fluoroprop-2-enamide.
| Compound Name | N-[2-[[5-ethyl-2-[[(1S,3S)-3-fluorocyclohexyl]methoxy]-6-[[(8-methylnaphthalen-1-yl)amino]methyl]pyrimidin-4-yl]amino]ethyl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 142595681 |
| Molecular Formula | C30H37F2N5O2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | N-[2-[[5-ethyl-2-[[(1S,3S)-3-fluorocyclohexyl]methoxy]-6-[[(8-methylnaphthalen-1-yl)amino]methyl]pyrimidin-4-yl]amino]ethyl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)NCCNc1nc(OC[C@H]2CCC[C@H](F)C2)nc(CNc2cccc3cccc(C)c23)c1CC |
| InChI | InChI=1S/C30H37F2N5O2/c1-4-24-26(17-35-25-13-7-11-22-10-5-8-19(2)27(22)25)36-30(39-18-21-9-6-12-23(32)16-21)37-28(24)33-14-15-34-29(38)20(3)31/h5,7-8,10-11,13,21,23,35H,3-4,6,9,12,14-18H2,1-2H3,(H,34,38)(H,33,36,37)/t21-,23-/m0/s1 |
| InChIKey | DTRKVRABQTZILS-GMAHTHKFSA-N |
| XLogP | 6.03 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|