C13H19BrF2N2 — CID 142598031
N-(4-bromo-2,6-difluorophenyl)-N'-propan-2-ylethanimidamide;ethane (PubChem CID 142598031) has the molecular formula C13H19BrF2N2 and a molecular weight of 321.21 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-N'-propan-2-ylethanimidamide;ethane.
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-N'-propan-2-ylethanimidamide;ethane |
|---|---|
| PubChem CID | 142598031 |
| Molecular Formula | C13H19BrF2N2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-N'-propan-2-ylethanimidamide;ethane |
| SMILES | C/C(=N\C(C)C)Nc1c(F)cc(Br)cc1F.CC |
| InChI | InChI=1S/C11H13BrF2N2.C2H6/c1-6(2)15-7(3)16-11-9(13)4-8(12)5-10(11)14;1-2/h4-6H,1-3H3,(H,15,16);1-2H3 |
| InChIKey | TUYZOZFJVMVVBO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|