C11H10BrF5N2 — CID 154967751
N-(4-bromo-2,6-difluorophenyl)-2,2,2-trifluoro-N'-propan-2-ylethanimidamide (PubChem CID 154967751) has the molecular formula C11H10BrF5N2 and a molecular weight of 345.11 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-2,2,2-trifluoro-N'-propan-2-ylethanimidamide.
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-2,2,2-trifluoro-N'-propan-2-ylethanimidamide |
|---|---|
| PubChem CID | 154967751 |
| Molecular Formula | C11H10BrF5N2 |
| Molecular Weight | 345.11 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-2,2,2-trifluoro-N'-propan-2-ylethanimidamide |
| SMILES | CC(C)/N=C(/Nc1c(F)cc(Br)cc1F)C(F)(F)F |
| InChI | InChI=1S/C11H10BrF5N2/c1-5(2)18-10(11(15,16)17)19-9-7(13)3-6(12)4-8(9)14/h3-5H,1-2H3,(H,18,19) |
| InChIKey | RWZKZRYTOKEETH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.11 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|