C15H23N3O4 — CID 142599664
tert-butyl 4-(2-methoxyethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 142599664) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is tert-butyl 4-(2-methoxyethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | tert-butyl 4-(2-methoxyethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 142599664 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl 4-(2-methoxyethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | COCCOc1ncnc2c1CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C15H23N3O4/c1-15(2,3)22-14(19)18-6-5-11-12(9-18)16-10-17-13(11)21-8-7-20-4/h10H,5-9H2,1-4H3 |
| InChIKey | UIUXNZHCEIAPKQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|