C16H23N3O4 — CID 170992073
tert-butyl 3-(methoxymethylcarbamoyl)-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate (PubChem CID 170992073) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is tert-butyl 3-(methoxymethylcarbamoyl)-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate.
| Compound Name | tert-butyl 3-(methoxymethylcarbamoyl)-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate |
|---|---|
| PubChem CID | 170992073 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | tert-butyl 3-(methoxymethylcarbamoyl)-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate |
| SMILES | COCNC(=O)c1cnc2c(c1)CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C16H23N3O4/c1-16(2,3)23-15(21)19-6-5-11-7-12(8-17-13(11)9-19)14(20)18-10-22-4/h7-8H,5-6,9-10H2,1-4H3,(H,18,20) |
| InChIKey | IZDSRISIYCQHLF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|