C14H11FO3S — CID 142599746
6-(3-fluoro-4-methoxyphenyl)-1,3λ4-benzoxathiole 3-oxide (PubChem CID 142599746) has the molecular formula C14H11FO3S and a molecular weight of 278.30 g/mol. Its IUPAC name is 6-(3-fluoro-4-methoxyphenyl)-1,3λ4-benzoxathiole 3-oxide.
| Compound Name | 6-(3-fluoro-4-methoxyphenyl)-1,3λ4-benzoxathiole 3-oxide |
|---|---|
| PubChem CID | 142599746 |
| Molecular Formula | C14H11FO3S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 6-(3-fluoro-4-methoxyphenyl)-1,3λ4-benzoxathiole 3-oxide |
| SMILES | COc1ccc(-c2ccc3c(c2)OCS3=O)cc1F |
| InChI | InChI=1S/C14H11FO3S/c1-17-12-4-2-9(6-11(12)15)10-3-5-14-13(7-10)18-8-19(14)16/h2-7H,8H2,1H3 |
| InChIKey | AWWCCYQZQHUOPH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |