C11H13BrFN3O2 — CID 142599995
methyl 2-[1-(5-bromo-6-fluoropyrazin-2-yl)pyrrolidin-3-yl]acetate (PubChem CID 142599995) has the molecular formula C11H13BrFN3O2 and a molecular weight of 318.15 g/mol. Its IUPAC name is methyl 2-[1-(5-bromo-6-fluoropyrazin-2-yl)pyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[1-(5-bromo-6-fluoropyrazin-2-yl)pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 142599995 |
| Molecular Formula | C11H13BrFN3O2 |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | methyl 2-[1-(5-bromo-6-fluoropyrazin-2-yl)pyrrolidin-3-yl]acetate |
| SMILES | COC(=O)CC1CCN(c2cnc(Br)c(F)n2)C1 |
| InChI | InChI=1S/C11H13BrFN3O2/c1-18-9(17)4-7-2-3-16(6-7)8-5-14-10(12)11(13)15-8/h5,7H,2-4,6H2,1H3 |
| InChIKey | NMYGZWBAHUEWDZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |