C18H28BrFN2O2 — CID 162730128
ethane;ethyl 2-[1-(6-bromo-2-ethyl-4-fluoro-3-pyridinyl)piperidin-3-yl]acetate (PubChem CID 162730128) has the molecular formula C18H28BrFN2O2 and a molecular weight of 403.34 g/mol. Its IUPAC name is ethane;ethyl 2-[1-(6-bromo-2-ethyl-4-fluoro-3-pyridinyl)piperidin-3-yl]acetate.
| Compound Name | ethane;ethyl 2-[1-(6-bromo-2-ethyl-4-fluoro-3-pyridinyl)piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 162730128 |
| Molecular Formula | C18H28BrFN2O2 |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | ethane;ethyl 2-[1-(6-bromo-2-ethyl-4-fluoro-3-pyridinyl)piperidin-3-yl]acetate |
| SMILES | CC.CCOC(=O)CC1CCCN(c2c(F)cc(Br)nc2CC)C1 |
| InChI | InChI=1S/C16H22BrFN2O2.C2H6/c1-3-13-16(12(18)9-14(17)19-13)20-7-5-6-11(10-20)8-15(21)22-4-2;1-2/h9,11H,3-8,10H2,1-2H3;1-2H3 |
| InChIKey | IFKIQENVSHVXCB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|