C14H10N2O2 — CID 142600310
3-(3-nitrophenyl)bicyclo[2.2.1]hepta-2,5-diene-2-carbonitrile (PubChem CID 142600310) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 3-(3-nitrophenyl)bicyclo[2.2.1]hepta-2,5-diene-2-carbonitrile.
| Compound Name | 3-(3-nitrophenyl)bicyclo[2.2.1]hepta-2,5-diene-2-carbonitrile |
|---|---|
| PubChem CID | 142600310 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 3-(3-nitrophenyl)bicyclo[2.2.1]hepta-2,5-diene-2-carbonitrile |
| SMILES | N#CC1=C(c2cccc([N+](=O)[O-])c2)C2C=CC1C2 |
| InChI | InChI=1S/C14H10N2O2/c15-8-13-9-4-5-11(6-9)14(13)10-2-1-3-12(7-10)16(17)18/h1-5,7,9,11H,6H2 |
| InChIKey | OCVKFKOXRYLLDZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|