C20H14BrN3O — CID 1426006
2-[5-bromo-1-[(2,4-dimethylphenyl)methyl]-2-oxoindol-3-ylidene]propanedinitrile (PubChem CID 1426006) has the molecular formula C20H14BrN3O and a molecular weight of 392.26 g/mol. Its IUPAC name is 2-[5-bromo-1-[(2,4-dimethylphenyl)methyl]-2-oxoindol-3-ylidene]propanedinitrile.
| Compound Name | 2-[5-bromo-1-[(2,4-dimethylphenyl)methyl]-2-oxoindol-3-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 1426006 |
| Molecular Formula | C20H14BrN3O |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 2-[5-bromo-1-[(2,4-dimethylphenyl)methyl]-2-oxoindol-3-ylidene]propanedinitrile |
| SMILES | Cc1ccc(CN2C(=O)C(=C(C#N)C#N)c3cc(Br)ccc32)c(C)c1 |
| InChI | InChI=1S/C20H14BrN3O/c1-12-3-4-14(13(2)7-12)11-24-18-6-5-16(21)8-17(18)19(20(24)25)15(9-22)10-23/h3-8H,11H2,1-2H3 |
| InChIKey | LIFKVVPCIHODCY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|