C17H33NO11 — CID 142600837
2-[5-(5-aminopentoxy)-2-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 142600837) has the molecular formula C17H33NO11 and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-[5-(5-aminopentoxy)-2-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[5-(5-aminopentoxy)-2-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 142600837 |
| Molecular Formula | C17H33NO11 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-[5-(5-aminopentoxy)-2-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | NCCCCCOC1OC([C@H](O)CO)C(OC2OC(CO)C(O)C(O)C2O)C1O |
| InChI | InChI=1S/C17H33NO11/c18-4-2-1-3-5-26-16-13(25)15(14(28-16)8(21)6-19)29-17-12(24)11(23)10(22)9(7-20)27-17/h8-17,19-25H,1-7,18H2/t8-,9?,10?,11?,12?,13?,14?,15?,16?,17?/m1/s1 |
| InChIKey | QQCRIBVWIVBJGC-IGSZPBAJSA-N |
| XLogP | -4.24 |
| TPSA | 204.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | -4.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|